About 1-[2-[(3,4-dimethoxyphenyl)iminomethyl]-3-hydroxyindol-1-yl]ethanone
1-[2-[(3,4-dimethoxyphenyl)iminomethyl]-3-hydroxyindol-1-yl]ethanone (PubChem CID 177379988) has the molecular formula C19H18N2O4
and a molecular weight of 338.36 g/mol. Its IUPAC name is 1-[2-[(3,4-dimethoxyphenyl)iminomethyl]-3-hydroxyindol-1-yl]ethanone.
Molecular Properties
| Compound Name | 1-[2-[(3,4-dimethoxyphenyl)iminomethyl]-3-hydroxyindol-1-yl]ethanone |
| PubChem CID | 177379988 |
| Molecular Formula | C19H18N2O4 |
| Molecular Weight | 338.36 g/mol |
| Exact Mass | 338.13 |
| IUPAC Name | 1-[2-[(3,4-dimethoxyphenyl)iminomethyl]-3-hydroxyindol-1-yl]ethanone |
| SMILES | COc1ccc(/N=C/c2c(O)c3ccccc3n2C(C)=O)cc1OC |
| InChI | InChI=1S/C19H18N2O4/c1-12(22)21-15-7-5-4-6-14(15)19(23)16(21)11-20-13-8-9-17(24-2)18(10-13)25-3/h4-11,23H,1-3H3/b20-11+ |
| InChIKey | JYUDPXMXVHRSLC-RGVLZGJSSA-N |
| XLogP | 3.77 |
| TPSA | 73.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.36 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 1-[2-[(3,4-dimethoxyphenyl)iminomethyl]-3-hydroxyindol-1-yl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-[(3,4-dimethoxyphenyl)iminomethyl]-3-hydroxyindol-1-yl]ethanone?
The IUPAC name of 1-[2-[(3,4-dimethoxyphenyl)iminomethyl]-3-hydroxyindol-1-yl]ethanone (CID 177379988) is 1-[2-[(3,4-dimethoxyphenyl)iminomethyl]-3-hydroxyindol-1-yl]ethanone.
What is the SMILES notation for 1-[2-[(3,4-dimethoxyphenyl)iminomethyl]-3-hydroxyindol-1-yl]ethanone?
The canonical SMILES for 1-[2-[(3,4-dimethoxyphenyl)iminomethyl]-3-hydroxyindol-1-yl]ethanone is COc1ccc(/N=C/c2c(O)c3ccccc3n2C(C)=O)cc1OC.
What is the InChIKey of 1-[2-[(3,4-dimethoxyphenyl)iminomethyl]-3-hydroxyindol-1-yl]ethanone?
The InChIKey is JYUDPXMXVHRSLC-RGVLZGJSSA-N. The full InChI is InChI=1S/C19H18N2O4/c1-12(22)21-15-7-5-4-6-14(15)19(23)16(21)11-20-13-8-9-17(24-2)18(10-13)25-3/h4-11,23H,1-3H3/b20-11+.
What are the key properties of 1-[2-[(3,4-dimethoxyphenyl)iminomethyl]-3-hydroxyindol-1-yl]ethanone?
1-[2-[(3,4-dimethoxyphenyl)iminomethyl]-3-hydroxyindol-1-yl]ethanone has a molecular weight of 338.36 g/mol, XLogP of 3.77, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-[(3,4-dimethoxyphenyl)iminomethyl]-3-hydroxyindol-1-yl]ethanone is sourced from PubChem (CID 177379988), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).