C14H9Cl3N2O4S — CID 177381718
[(E)-(3-chlorophenyl)methylideneamino] 2,4-dichloro-5-sulfamoylbenzoate (PubChem CID 177381718) has the molecular formula C14H9Cl3N2O4S and a molecular weight of 407.66 g/mol. Its IUPAC name is [(E)-(3-chlorophenyl)methylideneamino] 2,4-dichloro-5-sulfamoylbenzoate.
| Compound Name | [(E)-(3-chlorophenyl)methylideneamino] 2,4-dichloro-5-sulfamoylbenzoate |
|---|---|
| PubChem CID | 177381718 |
| Molecular Formula | C14H9Cl3N2O4S |
| Molecular Weight | 407.66 g/mol |
| Exact Mass | 405.93 |
| IUPAC Name | [(E)-(3-chlorophenyl)methylideneamino] 2,4-dichloro-5-sulfamoylbenzoate |
| SMILES | NS(=O)(=O)c1cc(C(=O)O/N=C/c2cccc(Cl)c2)c(Cl)cc1Cl |
| InChI | InChI=1S/C14H9Cl3N2O4S/c15-9-3-1-2-8(4-9)7-19-23-14(20)10-5-13(24(18,21)22)12(17)6-11(10)16/h1-7H,(H2,18,21,22)/b19-7+ |
| InChIKey | KTTISXIPINXGRG-FBCYGCLPSA-N |
| XLogP | 3.49 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.66 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|