C22H25BrN6O3 — CID 177382573
1-[4-amino-6-[[(1R,2S,3R,4S)-4-[2-(2-amino-3-bromoquinolin-7-yl)ethyl]-2,3-dihydroxycyclopentyl]amino]pyrimidin-5-yl]ethanone (PubChem CID 177382573) has the molecular formula C22H25BrN6O3 and a molecular weight of 501.39 g/mol. Its IUPAC name is 1-[4-amino-6-[[(1R,2S,3R,4S)-4-[2-(2-amino-3-bromoquinolin-7-yl)ethyl]-2,3-dihydroxycyclopentyl]amino]pyrimidin-5-yl]ethanone.
| Compound Name | 1-[4-amino-6-[[(1R,2S,3R,4S)-4-[2-(2-amino-3-bromoquinolin-7-yl)ethyl]-2,3-dihydroxycyclopentyl]amino]pyrimidin-5-yl]ethanone |
|---|---|
| PubChem CID | 177382573 |
| Molecular Formula | C22H25BrN6O3 |
| Molecular Weight | 501.39 g/mol |
| Exact Mass | 500.12 |
| IUPAC Name | 1-[4-amino-6-[[(1R,2S,3R,4S)-4-[2-(2-amino-3-bromoquinolin-7-yl)ethyl]-2,3-dihydroxycyclopentyl]amino]pyrimidin-5-yl]ethanone |
| SMILES | CC(=O)c1c(N)ncnc1N[C@@H]1C[C@H](CCc2ccc3cc(Br)c(N)nc3c2)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C22H25BrN6O3/c1-10(30)17-21(25)26-9-27-22(17)29-16-8-13(18(31)19(16)32)5-3-11-2-4-12-7-14(23)20(24)28-15(12)6-11/h2,4,6-7,9,13,16,18-19,31-32H,3,5,8H2,1H3,(H2,24,28)(H3,25,26,27,29)/t13-,16+,18+,19-/m0/s1 |
| InChIKey | WJXXUQNXLPSLSR-QVSURHGTSA-N |
| XLogP | 2.31 |
| TPSA | 160.27 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.39 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |