C27H35F3N2O — CID 177384660
2-[(E)-[(2S)-2-benzhydrylpyrrolidin-1-yl]iminomethyl]-1,1,1-trifluorononan-2-ol (PubChem CID 177384660) has the molecular formula C27H35F3N2O and a molecular weight of 460.58 g/mol. Its IUPAC name is 2-[(E)-[(2S)-2-benzhydrylpyrrolidin-1-yl]iminomethyl]-1,1,1-trifluorononan-2-ol.
| Compound Name | 2-[(E)-[(2S)-2-benzhydrylpyrrolidin-1-yl]iminomethyl]-1,1,1-trifluorononan-2-ol |
|---|---|
| PubChem CID | 177384660 |
| Molecular Formula | C27H35F3N2O |
| Molecular Weight | 460.58 g/mol |
| Exact Mass | 460.27 |
| IUPAC Name | 2-[(E)-[(2S)-2-benzhydrylpyrrolidin-1-yl]iminomethyl]-1,1,1-trifluorononan-2-ol |
| SMILES | CCCCCCCC(O)(/C=N/N1CCC[C@H]1C(c1ccccc1)c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C27H35F3N2O/c1-2-3-4-5-12-19-26(33,27(28,29)30)21-31-32-20-13-18-24(32)25(22-14-8-6-9-15-22)23-16-10-7-11-17-23/h6-11,14-17,21,24-25,33H,2-5,12-13,18-20H2,1H3/b31-21+/t24-,26?/m0/s1 |
| InChIKey | ISXQUZWTZQKOFG-CDNNUXOXSA-N |
| XLogP | 6.92 |
| TPSA | 35.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.58 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|