C25H34O4Si — CID 177388261
methyl 2-[(1R,4E,8S)-8-[tert-butyl(dimethyl)silyl]oxy-1-methyl-10-bicyclo[7.3.1]trideca-4,9-dien-2,6-diynyl]-3-oxobutanoate (PubChem CID 177388261) has the molecular formula C25H34O4Si and a molecular weight of 426.63 g/mol. Its IUPAC name is methyl 2-[(1R,4E,8S)-8-[tert-butyl(dimethyl)silyl]oxy-1-methyl-10-bicyclo[7.3.1]trideca-4,9-dien-2,6-diynyl]-3-oxobutanoate.
| Compound Name | methyl 2-[(1R,4E,8S)-8-[tert-butyl(dimethyl)silyl]oxy-1-methyl-10-bicyclo[7.3.1]trideca-4,9-dien-2,6-diynyl]-3-oxobutanoate |
|---|---|
| PubChem CID | 177388261 |
| Molecular Formula | C25H34O4Si |
| Molecular Weight | 426.63 g/mol |
| Exact Mass | 426.22 |
| IUPAC Name | methyl 2-[(1R,4E,8S)-8-[tert-butyl(dimethyl)silyl]oxy-1-methyl-10-bicyclo[7.3.1]trideca-4,9-dien-2,6-diynyl]-3-oxobutanoate |
| SMILES | COC(=O)C(C(C)=O)C1=C2C[C@](C)(C#C/C=C\C#C[C@@H]2O[Si](C)(C)C(C)(C)C)CC1 |
| InChI | InChI=1S/C25H34O4Si/c1-18(26)22(23(27)28-6)19-14-16-25(5)15-12-10-9-11-13-21(20(19)17-25)29-30(7,8)24(2,3)4/h9-10,21-22H,14,16-17H2,1-8H3/b10-9-/t21-,22?,25+/m0/s1 |
| InChIKey | KMGBDKYBPRNVMO-QUEGQLIKSA-N |
| XLogP | 4.82 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.63 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|