C22H30O4Si — CID 134978373
methyl (2S,5Z,10R)-2-[tert-butyl(dimethyl)silyl]oxy-11-methoxybicyclo[7.2.2]trideca-1(11),5-dien-3,7-diyne-10-carboxylate (PubChem CID 134978373) has the molecular formula C22H30O4Si and a molecular weight of 386.56 g/mol. Its IUPAC name is methyl (2S,5Z,10R)-2-[tert-butyl(dimethyl)silyl]oxy-11-methoxybicyclo[7.2.2]trideca-1(11),5-dien-3,7-diyne-10-carboxylate.
| Compound Name | methyl (2S,5Z,10R)-2-[tert-butyl(dimethyl)silyl]oxy-11-methoxybicyclo[7.2.2]trideca-1(11),5-dien-3,7-diyne-10-carboxylate |
|---|---|
| PubChem CID | 134978373 |
| Molecular Formula | C22H30O4Si |
| Molecular Weight | 386.56 g/mol |
| Exact Mass | 386.19 |
| IUPAC Name | methyl (2S,5Z,10R)-2-[tert-butyl(dimethyl)silyl]oxy-11-methoxybicyclo[7.2.2]trideca-1(11),5-dien-3,7-diyne-10-carboxylate |
| SMILES | COC(=O)[C@H]1C(OC)=C2CCC1C#C/C=C\C#C[C@@H]2O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H30O4Si/c1-22(2,3)27(6,7)26-18-13-11-9-8-10-12-16-14-15-17(18)20(24-4)19(16)21(23)25-5/h8-9,16,18-19H,14-15H2,1-7H3/b9-8-/t16?,18-,19+/m0/s1 |
| InChIKey | SSPBOXBOQPSPJD-PHEHUQMTSA-N |
| XLogP | 4.05 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.56 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|