C24H29NO2 — CID 177393225
(16R,17S,18S,21S)-17-(hydroxymethyl)-16,17,21-trimethyl-10-azapentacyclo[11.8.0.03,11.04,9.016,21]henicosa-1,3(11),4,6,8,12-hexaen-18-ol (PubChem CID 177393225) has the molecular formula C24H29NO2 and a molecular weight of 363.50 g/mol. Its IUPAC name is (16R,17S,18S,21S)-17-(hydroxymethyl)-16,17,21-trimethyl-10-azapentacyclo[11.8.0.03,11.04,9.016,21]henicosa-1,3(11),4,6,8,12-hexaen-18-ol.
| Compound Name | (16R,17S,18S,21S)-17-(hydroxymethyl)-16,17,21-trimethyl-10-azapentacyclo[11.8.0.03,11.04,9.016,21]henicosa-1,3(11),4,6,8,12-hexaen-18-ol |
|---|---|
| PubChem CID | 177393225 |
| Molecular Formula | C24H29NO2 |
| Molecular Weight | 363.50 g/mol |
| Exact Mass | 363.22 |
| IUPAC Name | (16R,17S,18S,21S)-17-(hydroxymethyl)-16,17,21-trimethyl-10-azapentacyclo[11.8.0.03,11.04,9.016,21]henicosa-1,3(11),4,6,8,12-hexaen-18-ol |
| SMILES | C[C@@]12CCc3cc4[nH]c5ccccc5c4cc3[C@@]1(C)CC[C@H](O)[C@]2(C)CO |
| InChI | InChI=1S/C24H29NO2/c1-22-10-9-21(27)23(2,14-26)24(22,3)11-8-15-12-20-17(13-18(15)22)16-6-4-5-7-19(16)25-20/h4-7,12-13,21,25-27H,8-11,14H2,1-3H3/t21-,22+,23-,24+/m0/s1 |
| InChIKey | QOYBUXAGOLWCMI-UARRHKHWSA-N |
| XLogP | 4.68 |
| TPSA | 56.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.50 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |