C9H9NO3S — CID 177393746
(3R)-3-[(R)-hydroxy(thiophen-2-yl)methyl]pyrrolidine-2,5-dione (PubChem CID 177393746) has the molecular formula C9H9NO3S and a molecular weight of 211.24 g/mol. Its IUPAC name is (3R)-3-[(R)-hydroxy(thiophen-2-yl)methyl]pyrrolidine-2,5-dione.
| Compound Name | (3R)-3-[(R)-hydroxy(thiophen-2-yl)methyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 177393746 |
| Molecular Formula | C9H9NO3S |
| Molecular Weight | 211.24 g/mol |
| Exact Mass | 211.03 |
| IUPAC Name | (3R)-3-[(R)-hydroxy(thiophen-2-yl)methyl]pyrrolidine-2,5-dione |
| SMILES | O=C1C[C@H]([C@@H](O)c2cccs2)C(=O)N1 |
| InChI | InChI=1S/C9H9NO3S/c11-7-4-5(9(13)10-7)8(12)6-2-1-3-14-6/h1-3,5,8,12H,4H2,(H,10,11,13)/t5-,8-/m1/s1 |
| InChIKey | HARNTFGNSKNWCE-SVGQVSJJSA-N |
| XLogP | 0.44 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.24 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|