C32H40O6 — CID 177394064
(1S,2S,3E,7R,9S,12S,13S,18S,20R)-14,20-dihydroxy-7,12,13,20-tetramethyl-18-phenyl-4-propan-2-yl-8,19-dioxapentacyclo[11.6.2.01,15.02,12.07,9]henicosa-3,14-diene-16,21-dione (PubChem CID 177394064) has the molecular formula C32H40O6 and a molecular weight of 520.67 g/mol. Its IUPAC name is (1S,2S,3E,7R,9S,12S,13S,18S,20R)-14,20-dihydroxy-7,12,13,20-tetramethyl-18-phenyl-4-propan-2-yl-8,19-dioxapentacyclo[11.6.2.01,15.02,12.07,9]henicosa-3,14-diene-16,21-dione.
| Compound Name | (1S,2S,3E,7R,9S,12S,13S,18S,20R)-14,20-dihydroxy-7,12,13,20-tetramethyl-18-phenyl-4-propan-2-yl-8,19-dioxapentacyclo[11.6.2.01,15.02,12.07,9]henicosa-3,14-diene-16,21-dione |
|---|---|
| PubChem CID | 177394064 |
| Molecular Formula | C32H40O6 |
| Molecular Weight | 520.67 g/mol |
| Exact Mass | 520.28 |
| IUPAC Name | (1S,2S,3E,7R,9S,12S,13S,18S,20R)-14,20-dihydroxy-7,12,13,20-tetramethyl-18-phenyl-4-propan-2-yl-8,19-dioxapentacyclo[11.6.2.01,15.02,12.07,9]henicosa-3,14-diene-16,21-dione |
| SMILES | CC(C)/C1=C/[C@H]2[C@](C)(CC[C@@H]3O[C@]3(C)CC1)[C@]1(C)C(=O)[C@](C)(O)[C@]23O[C@H](c2ccccc2)CC(=O)C3=C1O |
| InChI | InChI=1S/C32H40O6/c1-18(2)20-12-15-29(4)24(38-29)13-14-28(3)23(16-20)32-25(26(34)30(28,5)27(35)31(32,6)36)21(33)17-22(37-32)19-10-8-7-9-11-19/h7-11,16,18,22-24,34,36H,12-15,17H2,1-6H3/b20-16+/t22-,23-,24-,28-,29+,30-,31-,32-/m0/s1 |
| InChIKey | DMRQRWNUOZXZCU-SXMQLONCSA-N |
| XLogP | 5.56 |
| TPSA | 96.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.67 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|