C20H32O2 — CID 56643507
(1R,3S,6R,8R,11Z,13S)-3,8-dimethyl-14-methylidene-11-propan-2-yl-7-oxatricyclo[11.2.0.06,8]pentadec-11-en-1-ol (PubChem CID 56643507) has the molecular formula C20H32O2 and a molecular weight of 304.47 g/mol. Its IUPAC name is (1R,3S,6R,8R,11Z,13S)-3,8-dimethyl-14-methylidene-11-propan-2-yl-7-oxatricyclo[11.2.0.06,8]pentadec-11-en-1-ol.
| Compound Name | (1R,3S,6R,8R,11Z,13S)-3,8-dimethyl-14-methylidene-11-propan-2-yl-7-oxatricyclo[11.2.0.06,8]pentadec-11-en-1-ol |
|---|---|
| PubChem CID | 56643507 |
| Molecular Formula | C20H32O2 |
| Molecular Weight | 304.47 g/mol |
| Exact Mass | 304.24 |
| IUPAC Name | (1R,3S,6R,8R,11Z,13S)-3,8-dimethyl-14-methylidene-11-propan-2-yl-7-oxatricyclo[11.2.0.06,8]pentadec-11-en-1-ol |
| SMILES | C=C1C[C@]2(O)C[C@@H](C)CC[C@H]3O[C@]3(C)CC/C(C(C)C)=C/[C@@H]12 |
| InChI | InChI=1S/C20H32O2/c1-13(2)16-8-9-19(5)18(22-19)7-6-14(3)11-20(21)12-15(4)17(20)10-16/h10,13-14,17-18,21H,4,6-9,11-12H2,1-3,5H3/b16-10-/t14-,17-,18+,19+,20+/m0/s1 |
| InChIKey | STPQAYUIPGGGBQ-JEVCWHSGSA-N |
| XLogP | 4.63 |
| TPSA | 32.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.47 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|