C23H23N3S — CID 177394873
2-[(5E)-4-hexyl-5-(1-methylquinolin-4-ylidene)thiophen-2-ylidene]propanedinitrile (PubChem CID 177394873) has the molecular formula C23H23N3S and a molecular weight of 373.53 g/mol. Its IUPAC name is 2-[(5E)-4-hexyl-5-(1-methylquinolin-4-ylidene)thiophen-2-ylidene]propanedinitrile.
| Compound Name | 2-[(5E)-4-hexyl-5-(1-methylquinolin-4-ylidene)thiophen-2-ylidene]propanedinitrile |
|---|---|
| PubChem CID | 177394873 |
| Molecular Formula | C23H23N3S |
| Molecular Weight | 373.53 g/mol |
| Exact Mass | 373.16 |
| IUPAC Name | 2-[(5E)-4-hexyl-5-(1-methylquinolin-4-ylidene)thiophen-2-ylidene]propanedinitrile |
| SMILES | CCCCCCc1cc(=C(C#N)C#N)s/c1=C1\C=CN(C)c2ccccc21 |
| InChI | InChI=1S/C23H23N3S/c1-3-4-5-6-9-17-14-22(18(15-24)16-25)27-23(17)20-12-13-26(2)21-11-8-7-10-19(20)21/h7-8,10-14H,3-6,9H2,1-2H3/b23-20+ |
| InChIKey | GFDDXGYDUBZBAK-BSYVCWPDSA-N |
| XLogP | 4.23 |
| TPSA | 50.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.53 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|