C18H18BrNO2 — CID 177396848
(Z)-5-(bromomethyl)-N-methoxy-3,3-diphenyloxolan-2-imine (PubChem CID 177396848) has the molecular formula C18H18BrNO2 and a molecular weight of 360.25 g/mol. Its IUPAC name is (Z)-5-(bromomethyl)-N-methoxy-3,3-diphenyloxolan-2-imine.
| Compound Name | (Z)-5-(bromomethyl)-N-methoxy-3,3-diphenyloxolan-2-imine |
|---|---|
| PubChem CID | 177396848 |
| Molecular Formula | C18H18BrNO2 |
| Molecular Weight | 360.25 g/mol |
| Exact Mass | 359.05 |
| IUPAC Name | (Z)-5-(bromomethyl)-N-methoxy-3,3-diphenyloxolan-2-imine |
| SMILES | CO/N=C1\OC(CBr)CC1(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H18BrNO2/c1-21-20-17-18(12-16(13-19)22-17,14-8-4-2-5-9-14)15-10-6-3-7-11-15/h2-11,16H,12-13H2,1H3/b20-17- |
| InChIKey | PPQYXTZHGROMAL-JZJYNLBNSA-N |
| XLogP | 4.12 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.25 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|