C21H43N9O — CID 177396933
(2S)-2-amino-N-[6-[2-aminoethyl-[2-(3,5-dimethylpyrazol-1-yl)ethyl]amino]hexyl]-5-(diaminomethylideneamino)pentanamide (PubChem CID 177396933) has the molecular formula C21H43N9O and a molecular weight of 437.64 g/mol. Its IUPAC name is (2S)-2-amino-N-[6-[2-aminoethyl-[2-(3,5-dimethylpyrazol-1-yl)ethyl]amino]hexyl]-5-(diaminomethylideneamino)pentanamide.
| Compound Name | (2S)-2-amino-N-[6-[2-aminoethyl-[2-(3,5-dimethylpyrazol-1-yl)ethyl]amino]hexyl]-5-(diaminomethylideneamino)pentanamide |
|---|---|
| PubChem CID | 177396933 |
| Molecular Formula | C21H43N9O |
| Molecular Weight | 437.64 g/mol |
| Exact Mass | 437.36 |
| IUPAC Name | (2S)-2-amino-N-[6-[2-aminoethyl-[2-(3,5-dimethylpyrazol-1-yl)ethyl]amino]hexyl]-5-(diaminomethylideneamino)pentanamide |
| SMILES | Cc1cc(C)n(CCN(CCN)CCCCCCNC(=O)[C@@H](N)CCCN=C(N)N)n1 |
| InChI | InChI=1S/C21H43N9O/c1-17-16-18(2)30(28-17)15-14-29(13-9-22)12-6-4-3-5-10-26-20(31)19(23)8-7-11-27-21(24)25/h16,19H,3-15,22-23H2,1-2H3,(H,26,31)(H4,24,25,27)/t19-/m0/s1 |
| InChIKey | GDOSNZXJSYILLX-IBGZPJMESA-N |
| XLogP | -0.18 |
| TPSA | 166.60 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.64 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|