C47H52N2O2S3 — CID 177400643
(Z)-2-cyano-3-[10-[5-(3,6-ditert-butylcarbazol-9-yl)-3-octylthiophen-2-yl]-7,7-dimethyl-3,11-dithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl]prop-2-enoic acid (PubChem CID 177400643) has the molecular formula C47H52N2O2S3 and a molecular weight of 773.15 g/mol. Its IUPAC name is (Z)-2-cyano-3-[10-[5-(3,6-ditert-butylcarbazol-9-yl)-3-octylthiophen-2-yl]-7,7-dimethyl-3,11-dithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl]prop-2-enoic acid.
| Compound Name | (Z)-2-cyano-3-[10-[5-(3,6-ditert-butylcarbazol-9-yl)-3-octylthiophen-2-yl]-7,7-dimethyl-3,11-dithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 177400643 |
| Molecular Formula | C47H52N2O2S3 |
| Molecular Weight | 773.15 g/mol |
| Exact Mass | 772.32 |
| IUPAC Name | (Z)-2-cyano-3-[10-[5-(3,6-ditert-butylcarbazol-9-yl)-3-octylthiophen-2-yl]-7,7-dimethyl-3,11-dithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl]prop-2-enoic acid |
| SMILES | CCCCCCCCc1cc(-n2c3ccc(C(C)(C)C)cc3c3cc(C(C)(C)C)ccc32)sc1-c1cc2c(s1)-c1sc(/C=C(/C#N)C(=O)O)cc1C2(C)C |
| InChI | InChI=1S/C47H52N2O2S3/c1-10-11-12-13-14-15-16-28-22-40(49-37-19-17-30(45(2,3)4)23-33(37)34-24-31(46(5,6)7)18-20-38(34)49)54-41(28)39-26-36-43(53-39)42-35(47(36,8)9)25-32(52-42)21-29(27-48)44(50)51/h17-26H,10-16H2,1-9H3,(H,50,51)/b29-21- |
| InChIKey | QCHGXSRRUDZEGE-ANYBSYGZSA-N |
| XLogP | 14.43 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 773.15 |
| LogP ≤ 5 | 14.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|