C18H21N2O5P — CID 177401078
3-(7-diethoxyphosphoryl-2,3-dihydro-1H-1,4-diazepin-5-yl)chromen-2-one (PubChem CID 177401078) has the molecular formula C18H21N2O5P and a molecular weight of 376.35 g/mol. Its IUPAC name is 3-(7-diethoxyphosphoryl-2,3-dihydro-1H-1,4-diazepin-5-yl)chromen-2-one.
| Compound Name | 3-(7-diethoxyphosphoryl-2,3-dihydro-1H-1,4-diazepin-5-yl)chromen-2-one |
|---|---|
| PubChem CID | 177401078 |
| Molecular Formula | C18H21N2O5P |
| Molecular Weight | 376.35 g/mol |
| Exact Mass | 376.12 |
| IUPAC Name | 3-(7-diethoxyphosphoryl-2,3-dihydro-1H-1,4-diazepin-5-yl)chromen-2-one |
| SMILES | CCOP(=O)(OCC)C1=CC(c2cc3ccccc3oc2=O)=NCCN1 |
| InChI | InChI=1S/C18H21N2O5P/c1-3-23-26(22,24-4-2)17-12-15(19-9-10-20-17)14-11-13-7-5-6-8-16(13)25-18(14)21/h5-8,11-12,20H,3-4,9-10H2,1-2H3 |
| InChIKey | IQGYTACTAYZHRS-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.35 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|