C31H35O3PS — CID 177402011
1-tert-butyl-4-(1-cyclohexylidene-2-diphenylphosphorylprop-2-enyl)sulfonylbenzene (PubChem CID 177402011) has the molecular formula C31H35O3PS and a molecular weight of 518.66 g/mol. Its IUPAC name is 1-tert-butyl-4-(1-cyclohexylidene-2-diphenylphosphorylprop-2-enyl)sulfonylbenzene.
| Compound Name | 1-tert-butyl-4-(1-cyclohexylidene-2-diphenylphosphorylprop-2-enyl)sulfonylbenzene |
|---|---|
| PubChem CID | 177402011 |
| Molecular Formula | C31H35O3PS |
| Molecular Weight | 518.66 g/mol |
| Exact Mass | 518.20 |
| IUPAC Name | 1-tert-butyl-4-(1-cyclohexylidene-2-diphenylphosphorylprop-2-enyl)sulfonylbenzene |
| SMILES | C=C(C(=C1CCCCC1)S(=O)(=O)c1ccc(C(C)(C)C)cc1)P(=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C31H35O3PS/c1-24(35(32,27-16-10-6-11-17-27)28-18-12-7-13-19-28)30(25-14-8-5-9-15-25)36(33,34)29-22-20-26(21-23-29)31(2,3)4/h6-7,10-13,16-23H,1,5,8-9,14-15H2,2-4H3 |
| InChIKey | YEVRUXZWHXNRAK-UHFFFAOYSA-N |
| XLogP | 7.50 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.66 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|