C32H24Cl2N4O2 — CID 177408764
(15R,16R)-15-N,16-N-bis[(E)-(4-chlorophenyl)methylideneamino]tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15,16-dicarboxamide (PubChem CID 177408764) has the molecular formula C32H24Cl2N4O2 and a molecular weight of 567.48 g/mol. Its IUPAC name is (15R,16R)-15-N,16-N-bis[(E)-(4-chlorophenyl)methylideneamino]tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15,16-dicarboxamide.
| Compound Name | (15R,16R)-15-N,16-N-bis[(E)-(4-chlorophenyl)methylideneamino]tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15,16-dicarboxamide |
|---|---|
| PubChem CID | 177408764 |
| Molecular Formula | C32H24Cl2N4O2 |
| Molecular Weight | 567.48 g/mol |
| Exact Mass | 566.13 |
| IUPAC Name | (15R,16R)-15-N,16-N-bis[(E)-(4-chlorophenyl)methylideneamino]tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15,16-dicarboxamide |
| SMILES | O=C(N/N=C/c1ccc(Cl)cc1)[C@@H]1C2c3ccccc3C(c3ccccc32)[C@H]1C(=O)N/N=C/c1ccc(Cl)cc1 |
| InChI | InChI=1S/C32H24Cl2N4O2/c33-21-13-9-19(10-14-21)17-35-37-31(39)29-27-23-5-1-2-6-24(23)28(26-8-4-3-7-25(26)27)30(29)32(40)38-36-18-20-11-15-22(34)16-12-20/h1-18,27-30H,(H,37,39)(H,38,40)/b35-17+,36-18+/t27?,28?,29-,30-/m1/s1 |
| InChIKey | DUURQKITCIQMOR-GNBNHAPISA-N |
| XLogP | 6.12 |
| TPSA | 82.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.48 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|