C20H28O6Si — CID 177417685
4-O-tert-butyl 3-O-methyl 5-phenyl-3-trimethylsilyloxy-2H-furan-3,4-dicarboxylate (PubChem CID 177417685) has the molecular formula C20H28O6Si and a molecular weight of 392.52 g/mol. Its IUPAC name is 4-O-tert-butyl 3-O-methyl 5-phenyl-3-trimethylsilyloxy-2H-furan-3,4-dicarboxylate.
| Compound Name | 4-O-tert-butyl 3-O-methyl 5-phenyl-3-trimethylsilyloxy-2H-furan-3,4-dicarboxylate |
|---|---|
| PubChem CID | 177417685 |
| Molecular Formula | C20H28O6Si |
| Molecular Weight | 392.52 g/mol |
| Exact Mass | 392.17 |
| IUPAC Name | 4-O-tert-butyl 3-O-methyl 5-phenyl-3-trimethylsilyloxy-2H-furan-3,4-dicarboxylate |
| SMILES | COC(=O)C1(O[Si](C)(C)C)COC(c2ccccc2)=C1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H28O6Si/c1-19(2,3)25-17(21)15-16(14-11-9-8-10-12-14)24-13-20(15,18(22)23-4)26-27(5,6)7/h8-12H,13H2,1-7H3 |
| InChIKey | YWCVOABUNOQGNG-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.52 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|