C29H29N3O5 — CID 177419500
2-[4-(dibutylamino)phenyl]-5-(5-nitro-1,3-benzoxazol-2-yl)-1-benzofuran-6-ol (PubChem CID 177419500) has the molecular formula C29H29N3O5 and a molecular weight of 499.57 g/mol. Its IUPAC name is 2-[4-(dibutylamino)phenyl]-5-(5-nitro-1,3-benzoxazol-2-yl)-1-benzofuran-6-ol.
| Compound Name | 2-[4-(dibutylamino)phenyl]-5-(5-nitro-1,3-benzoxazol-2-yl)-1-benzofuran-6-ol |
|---|---|
| PubChem CID | 177419500 |
| Molecular Formula | C29H29N3O5 |
| Molecular Weight | 499.57 g/mol |
| Exact Mass | 499.21 |
| IUPAC Name | 2-[4-(dibutylamino)phenyl]-5-(5-nitro-1,3-benzoxazol-2-yl)-1-benzofuran-6-ol |
| SMILES | CCCCN(CCCC)c1ccc(-c2cc3cc(-c4nc5cc([N+](=O)[O-])ccc5o4)c(O)cc3o2)cc1 |
| InChI | InChI=1S/C29H29N3O5/c1-3-5-13-31(14-6-4-2)21-9-7-19(8-10-21)27-16-20-15-23(25(33)18-28(20)36-27)29-30-24-17-22(32(34)35)11-12-26(24)37-29/h7-12,15-18,33H,3-6,13-14H2,1-2H3 |
| InChIKey | WEAWLQGZEQYZQT-UHFFFAOYSA-N |
| XLogP | 7.93 |
| TPSA | 105.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.57 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|