C55H65NSi2 — CID 177420706
2-[2-methyl-4,5,6,7-tetraphenyl-3-[2-tri(propan-2-yl)silylethynyl]isoindol-1-yl]ethynyl-tri(propan-2-yl)silane (PubChem CID 177420706) has the molecular formula C55H65NSi2 and a molecular weight of 796.30 g/mol. Its IUPAC name is 2-[2-methyl-4,5,6,7-tetraphenyl-3-[2-tri(propan-2-yl)silylethynyl]isoindol-1-yl]ethynyl-tri(propan-2-yl)silane.
| Compound Name | 2-[2-methyl-4,5,6,7-tetraphenyl-3-[2-tri(propan-2-yl)silylethynyl]isoindol-1-yl]ethynyl-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 177420706 |
| Molecular Formula | C55H65NSi2 |
| Molecular Weight | 796.30 g/mol |
| Exact Mass | 795.47 |
| IUPAC Name | 2-[2-methyl-4,5,6,7-tetraphenyl-3-[2-tri(propan-2-yl)silylethynyl]isoindol-1-yl]ethynyl-tri(propan-2-yl)silane |
| SMILES | CC(C)[Si](C#Cc1c2c(-c3ccccc3)c(-c3ccccc3)c(-c3ccccc3)c(-c3ccccc3)c2c(C#C[Si](C(C)C)(C(C)C)C(C)C)n1C)(C(C)C)C(C)C |
| InChI | InChI=1S/C55H65NSi2/c1-38(2)57(39(3)4,40(5)6)36-34-48-54-52(46-30-22-16-23-31-46)50(44-26-18-14-19-27-44)51(45-28-20-15-21-29-45)53(47-32-24-17-25-33-47)55(54)49(56(48)13)35-37-58(41(7)8,42(9)10)43(11)12/h14-33,38-43H,1-13H3 |
| InChIKey | NMKJQRRKCVKOPM-UHFFFAOYSA-N |
| XLogP | 15.99 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 796.30 |
| LogP ≤ 5 | 15.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|