C22H28N2Si — CID 101479437
2-(2-ethynyl-4-phenylimidazol-1-yl)ethynyl-tri(propan-2-yl)silane (PubChem CID 101479437) has the molecular formula C22H28N2Si and a molecular weight of 348.57 g/mol. Its IUPAC name is 2-(2-ethynyl-4-phenylimidazol-1-yl)ethynyl-tri(propan-2-yl)silane.
| Compound Name | 2-(2-ethynyl-4-phenylimidazol-1-yl)ethynyl-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 101479437 |
| Molecular Formula | C22H28N2Si |
| Molecular Weight | 348.57 g/mol |
| Exact Mass | 348.20 |
| IUPAC Name | 2-(2-ethynyl-4-phenylimidazol-1-yl)ethynyl-tri(propan-2-yl)silane |
| SMILES | C#Cc1nc(-c2ccccc2)cn1C#C[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C22H28N2Si/c1-8-22-23-21(20-12-10-9-11-13-20)16-24(22)14-15-25(17(2)3,18(4)5)19(6)7/h1,9-13,16-19H,2-7H3 |
| InChIKey | FOQAIPPWCDLAAW-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.57 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|