C16H19ClO3 — CID 177428823
methyl 2-[(2S,3R,4R,5R)-5-(4-chlorophenyl)-4-ethenyl-3-methyloxolan-2-yl]acetate (PubChem CID 177428823) has the molecular formula C16H19ClO3 and a molecular weight of 294.78 g/mol. Its IUPAC name is methyl 2-[(2S,3R,4R,5R)-5-(4-chlorophenyl)-4-ethenyl-3-methyloxolan-2-yl]acetate.
| Compound Name | methyl 2-[(2S,3R,4R,5R)-5-(4-chlorophenyl)-4-ethenyl-3-methyloxolan-2-yl]acetate |
|---|---|
| PubChem CID | 177428823 |
| Molecular Formula | C16H19ClO3 |
| Molecular Weight | 294.78 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | methyl 2-[(2S,3R,4R,5R)-5-(4-chlorophenyl)-4-ethenyl-3-methyloxolan-2-yl]acetate |
| SMILES | C=C[C@@H]1[C@@H](C)[C@H](CC(=O)OC)O[C@H]1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H19ClO3/c1-4-13-10(2)14(9-15(18)19-3)20-16(13)11-5-7-12(17)8-6-11/h4-8,10,13-14,16H,1,9H2,2-3H3/t10-,13-,14+,16+/m1/s1 |
| InChIKey | MIAPBDWHPAXLAI-ADDUCUOXSA-N |
| XLogP | 3.78 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.78 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|