C16H9BrN2O3 — CID 177429185
2-[(E)-[2-(4-bromophenyl)-2-oxoethylidene]amino]isoindole-1,3-dione (PubChem CID 177429185) has the molecular formula C16H9BrN2O3 and a molecular weight of 357.16 g/mol. Its IUPAC name is 2-[(E)-[2-(4-bromophenyl)-2-oxoethylidene]amino]isoindole-1,3-dione.
| Compound Name | 2-[(E)-[2-(4-bromophenyl)-2-oxoethylidene]amino]isoindole-1,3-dione |
|---|---|
| PubChem CID | 177429185 |
| Molecular Formula | C16H9BrN2O3 |
| Molecular Weight | 357.16 g/mol |
| Exact Mass | 355.98 |
| IUPAC Name | 2-[(E)-[2-(4-bromophenyl)-2-oxoethylidene]amino]isoindole-1,3-dione |
| SMILES | O=C(/C=N/N1C(=O)c2ccccc2C1=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C16H9BrN2O3/c17-11-7-5-10(6-8-11)14(20)9-18-19-15(21)12-3-1-2-4-13(12)16(19)22/h1-9H/b18-9+ |
| InChIKey | QIHMDYRZUYDLDL-GIJQJNRQSA-N |
| XLogP | 2.91 |
| TPSA | 66.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.16 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|