C24H17F2NO4 — CID 177431970
N-(5,5-difluoro-4-hydroxy-2-oxo-6,6-diphenylpyran-3-yl)benzamide (PubChem CID 177431970) has the molecular formula C24H17F2NO4 and a molecular weight of 421.40 g/mol. Its IUPAC name is N-(5,5-difluoro-4-hydroxy-2-oxo-6,6-diphenylpyran-3-yl)benzamide.
| Compound Name | N-(5,5-difluoro-4-hydroxy-2-oxo-6,6-diphenylpyran-3-yl)benzamide |
|---|---|
| PubChem CID | 177431970 |
| Molecular Formula | C24H17F2NO4 |
| Molecular Weight | 421.40 g/mol |
| Exact Mass | 421.11 |
| IUPAC Name | N-(5,5-difluoro-4-hydroxy-2-oxo-6,6-diphenylpyran-3-yl)benzamide |
| SMILES | O=C1OC(c2ccccc2)(c2ccccc2)C(F)(F)C(O)=C1NC(=O)c1ccccc1 |
| InChI | InChI=1S/C24H17F2NO4/c25-24(26)20(28)19(27-21(29)16-10-4-1-5-11-16)22(30)31-23(24,17-12-6-2-7-13-17)18-14-8-3-9-15-18/h1-15,28H,(H,27,29) |
| InChIKey | ZOOCLFLJWCCLEX-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.40 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |