C38H40N2 — CID 177432992
7,24-ditert-butyl-11,20-diethyl-11,20-diazaheptacyclo[15.11.0.02,14.04,12.05,10.019,27.021,26]octacosa-1(28),2,4(12),5(10),6,8,13,15,17,19(27),21(26),22,24-tridecaene (PubChem CID 177432992) has the molecular formula C38H40N2 and a molecular weight of 524.75 g/mol. Its IUPAC name is 7,24-ditert-butyl-11,20-diethyl-11,20-diazaheptacyclo[15.11.0.02,14.04,12.05,10.019,27.021,26]octacosa-1(28),2,4(12),5(10),6,8,13,15,17,19(27),21(26),22,24-tridecaene.
| Compound Name | 7,24-ditert-butyl-11,20-diethyl-11,20-diazaheptacyclo[15.11.0.02,14.04,12.05,10.019,27.021,26]octacosa-1(28),2,4(12),5(10),6,8,13,15,17,19(27),21(26),22,24-tridecaene |
|---|---|
| PubChem CID | 177432992 |
| Molecular Formula | C38H40N2 |
| Molecular Weight | 524.75 g/mol |
| Exact Mass | 524.32 |
| IUPAC Name | 7,24-ditert-butyl-11,20-diethyl-11,20-diazaheptacyclo[15.11.0.02,14.04,12.05,10.019,27.021,26]octacosa-1(28),2,4(12),5(10),6,8,13,15,17,19(27),21(26),22,24-tridecaene |
| SMILES | CCn1c2ccc(C(C)(C)C)cc2c2cc3c(ccc4cc5c(cc43)c3cc(C(C)(C)C)ccc3n5CC)cc21 |
| InChI | InChI=1S/C38H40N2/c1-9-39-33-15-13-25(37(3,4)5)19-29(33)31-21-27-23(17-35(31)39)11-12-24-18-36-32(22-28(24)27)30-20-26(38(6,7)8)14-16-34(30)40(36)10-2/h11-22H,9-10H2,1-8H3 |
| InChIKey | KEXRRCMGALWNIX-UHFFFAOYSA-N |
| XLogP | 10.84 |
| TPSA | 9.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.75 |
| LogP ≤ 5 | 10.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|