About 6-methoxy-9,9-dimethyl-2-propan-2-ylpyrano[3,2-h]chromen-4-one
6-methoxy-9,9-dimethyl-2-propan-2-ylpyrano[3,2-h]chromen-4-one (PubChem CID 177433590) has the molecular formula C18H20O4
and a molecular weight of 300.35 g/mol. Its IUPAC name is 6-methoxy-9,9-dimethyl-2-propan-2-ylpyrano[3,2-h]chromen-4-one.
Molecular Properties
| Compound Name | 6-methoxy-9,9-dimethyl-2-propan-2-ylpyrano[3,2-h]chromen-4-one |
| PubChem CID | 177433590 |
| Molecular Formula | C18H20O4 |
| Molecular Weight | 300.35 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | 6-methoxy-9,9-dimethyl-2-propan-2-ylpyrano[3,2-h]chromen-4-one |
| SMILES | COc1cc2c(=O)cc(C(C)C)oc2c2c1C=CC(C)(C)O2 |
| InChI | InChI=1S/C18H20O4/c1-10(2)14-9-13(19)12-8-15(20-5)11-6-7-18(3,4)22-17(11)16(12)21-14/h6-10H,1-5H3 |
| InChIKey | LOIKVAOGOHTAJO-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 48.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.35 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-methoxy-9,9-dimethyl-2-propan-2-ylpyrano[3,2-h]chromen-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methoxy-9,9-dimethyl-2-propan-2-ylpyrano[3,2-h]chromen-4-one?
The IUPAC name of 6-methoxy-9,9-dimethyl-2-propan-2-ylpyrano[3,2-h]chromen-4-one (CID 177433590) is 6-methoxy-9,9-dimethyl-2-propan-2-ylpyrano[3,2-h]chromen-4-one.
What is the SMILES notation for 6-methoxy-9,9-dimethyl-2-propan-2-ylpyrano[3,2-h]chromen-4-one?
The canonical SMILES for 6-methoxy-9,9-dimethyl-2-propan-2-ylpyrano[3,2-h]chromen-4-one is COc1cc2c(=O)cc(C(C)C)oc2c2c1C=CC(C)(C)O2.
What is the InChIKey of 6-methoxy-9,9-dimethyl-2-propan-2-ylpyrano[3,2-h]chromen-4-one?
The InChIKey is LOIKVAOGOHTAJO-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20O4/c1-10(2)14-9-13(19)12-8-15(20-5)11-6-7-18(3,4)22-17(11)16(12)21-14/h6-10H,1-5H3.
What are the key properties of 6-methoxy-9,9-dimethyl-2-propan-2-ylpyrano[3,2-h]chromen-4-one?
6-methoxy-9,9-dimethyl-2-propan-2-ylpyrano[3,2-h]chromen-4-one has a molecular weight of 300.35 g/mol, XLogP of 4.11, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methoxy-9,9-dimethyl-2-propan-2-ylpyrano[3,2-h]chromen-4-one is sourced from PubChem (CID 177433590), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).