C20H16O6 — CID 134816993
20-methoxy-16,16-dimethyl-2,5,7,15-tetraoxapentacyclo[11.8.0.03,11.04,8.014,19]henicosa-1(21),3(11),4(8),9,13,17,19-heptaen-12-one (PubChem CID 134816993) has the molecular formula C20H16O6 and a molecular weight of 352.34 g/mol. Its IUPAC name is 20-methoxy-16,16-dimethyl-2,5,7,15-tetraoxapentacyclo[11.8.0.03,11.04,8.014,19]henicosa-1(21),3(11),4(8),9,13,17,19-heptaen-12-one.
| Compound Name | 20-methoxy-16,16-dimethyl-2,5,7,15-tetraoxapentacyclo[11.8.0.03,11.04,8.014,19]henicosa-1(21),3(11),4(8),9,13,17,19-heptaen-12-one |
|---|---|
| PubChem CID | 134816993 |
| Molecular Formula | C20H16O6 |
| Molecular Weight | 352.34 g/mol |
| Exact Mass | 352.09 |
| IUPAC Name | 20-methoxy-16,16-dimethyl-2,5,7,15-tetraoxapentacyclo[11.8.0.03,11.04,8.014,19]henicosa-1(21),3(11),4(8),9,13,17,19-heptaen-12-one |
| SMILES | COc1cc2oc3c4c(ccc3c(=O)c2c2c1C=CC(C)(C)O2)OCO4 |
| InChI | InChI=1S/C20H16O6/c1-20(2)7-6-10-13(22-3)8-14-15(17(10)26-20)16(21)11-4-5-12-19(18(11)25-14)24-9-23-12/h4-8H,9H2,1-3H3 |
| InChIKey | KRLAKLSHAPDHPM-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 67.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.34 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|