About N-[(E)-3,3,3-trifluoro-1-(3-methylphenyl)prop-1-enyl]acetamide
N-[(E)-3,3,3-trifluoro-1-(3-methylphenyl)prop-1-enyl]acetamide (PubChem CID 177439804) has the molecular formula C12H12F3NO
and a molecular weight of 243.23 g/mol. Its IUPAC name is N-[(E)-3,3,3-trifluoro-1-(3-methylphenyl)prop-1-enyl]acetamide.
Molecular Properties
| Compound Name | N-[(E)-3,3,3-trifluoro-1-(3-methylphenyl)prop-1-enyl]acetamide |
| PubChem CID | 177439804 |
| Molecular Formula | C12H12F3NO |
| Molecular Weight | 243.23 g/mol |
| Exact Mass | 243.09 |
| IUPAC Name | N-[(E)-3,3,3-trifluoro-1-(3-methylphenyl)prop-1-enyl]acetamide |
| SMILES | CC(=O)N/C(=C/C(F)(F)F)c1cccc(C)c1 |
| InChI | InChI=1S/C12H12F3NO/c1-8-4-3-5-10(6-8)11(16-9(2)17)7-12(13,14)15/h3-7H,1-2H3,(H,16,17)/b11-7+ |
| InChIKey | OJDPXMHLIPBDNH-YRNVUSSQSA-N |
| XLogP | 3.03 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.23 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-[(E)-3,3,3-trifluoro-1-(3-methylphenyl)prop-1-enyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(E)-3,3,3-trifluoro-1-(3-methylphenyl)prop-1-enyl]acetamide?
The IUPAC name of N-[(E)-3,3,3-trifluoro-1-(3-methylphenyl)prop-1-enyl]acetamide (CID 177439804) is N-[(E)-3,3,3-trifluoro-1-(3-methylphenyl)prop-1-enyl]acetamide.
What is the SMILES notation for N-[(E)-3,3,3-trifluoro-1-(3-methylphenyl)prop-1-enyl]acetamide?
The canonical SMILES for N-[(E)-3,3,3-trifluoro-1-(3-methylphenyl)prop-1-enyl]acetamide is CC(=O)N/C(=C/C(F)(F)F)c1cccc(C)c1.
What is the InChIKey of N-[(E)-3,3,3-trifluoro-1-(3-methylphenyl)prop-1-enyl]acetamide?
The InChIKey is OJDPXMHLIPBDNH-YRNVUSSQSA-N. The full InChI is InChI=1S/C12H12F3NO/c1-8-4-3-5-10(6-8)11(16-9(2)17)7-12(13,14)15/h3-7H,1-2H3,(H,16,17)/b11-7+.
What are the key properties of N-[(E)-3,3,3-trifluoro-1-(3-methylphenyl)prop-1-enyl]acetamide?
N-[(E)-3,3,3-trifluoro-1-(3-methylphenyl)prop-1-enyl]acetamide has a molecular weight of 243.23 g/mol, XLogP of 3.03, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(E)-3,3,3-trifluoro-1-(3-methylphenyl)prop-1-enyl]acetamide is sourced from PubChem (CID 177439804), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).