C13H14ClF3O3 — CID 177440918
[4-(2-chloro-4,4,4-trifluorobutyl)-2-methoxyphenyl] acetate (PubChem CID 177440918) has the molecular formula C13H14ClF3O3 and a molecular weight of 310.70 g/mol. Its IUPAC name is [4-(2-chloro-4,4,4-trifluorobutyl)-2-methoxyphenyl] acetate.
| Compound Name | [4-(2-chloro-4,4,4-trifluorobutyl)-2-methoxyphenyl] acetate |
|---|---|
| PubChem CID | 177440918 |
| Molecular Formula | C13H14ClF3O3 |
| Molecular Weight | 310.70 g/mol |
| Exact Mass | 310.06 |
| IUPAC Name | [4-(2-chloro-4,4,4-trifluorobutyl)-2-methoxyphenyl] acetate |
| SMILES | COc1cc(CC(Cl)CC(F)(F)F)ccc1OC(C)=O |
| InChI | InChI=1S/C13H14ClF3O3/c1-8(18)20-11-4-3-9(6-12(11)19-2)5-10(14)7-13(15,16)17/h3-4,6,10H,5,7H2,1-2H3 |
| InChIKey | JXNDKHXZYJVFKY-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.70 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|