C23H24N — CID 177441649
CID 177441649 (PubChem CID 177441649) has the molecular formula C23H24N and a molecular weight of 314.45 g/mol.
| Compound Name | CID 177441649 |
|---|---|
| PubChem CID | 177441649 |
| Molecular Formula | C23H24N |
| Molecular Weight | 314.45 g/mol |
| Exact Mass | 314.19 |
| IUPAC Name | — |
| SMILES | Cc1cc(C)c([C]2c3ccccc3N(C)C3C=CC=CC23)c(C)c1 |
| InChI | InChI=1S/C23H24N/c1-15-13-16(2)22(17(3)14-15)23-18-9-5-7-11-20(18)24(4)21-12-8-6-10-19(21)23/h5-14,18,20H,1-4H3 |
| InChIKey | GXRYRZZDRDFFBT-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.45 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |