C29H38O8 — CID 177447675
(2Z)-2-[3-[(3aS,4R,9R,9aS)-9-acetyloxy-1,8-dihydroxy-1,4,7-trimethyl-5,6-dioxo-3,3a,9,9a-tetrahydro-2H-cyclopenta[b]naphthalen-4-yl]propylidene]-6-methylhept-5-enoic acid (PubChem CID 177447675) has the molecular formula C29H38O8 and a molecular weight of 514.62 g/mol. Its IUPAC name is (2Z)-2-[3-[(3aS,4R,9R,9aS)-9-acetyloxy-1,8-dihydroxy-1,4,7-trimethyl-5,6-dioxo-3,3a,9,9a-tetrahydro-2H-cyclopenta[b]naphthalen-4-yl]propylidene]-6-methylhept-5-enoic acid.
| Compound Name | (2Z)-2-[3-[(3aS,4R,9R,9aS)-9-acetyloxy-1,8-dihydroxy-1,4,7-trimethyl-5,6-dioxo-3,3a,9,9a-tetrahydro-2H-cyclopenta[b]naphthalen-4-yl]propylidene]-6-methylhept-5-enoic acid |
|---|---|
| PubChem CID | 177447675 |
| Molecular Formula | C29H38O8 |
| Molecular Weight | 514.62 g/mol |
| Exact Mass | 514.26 |
| IUPAC Name | (2Z)-2-[3-[(3aS,4R,9R,9aS)-9-acetyloxy-1,8-dihydroxy-1,4,7-trimethyl-5,6-dioxo-3,3a,9,9a-tetrahydro-2H-cyclopenta[b]naphthalen-4-yl]propylidene]-6-methylhept-5-enoic acid |
| SMILES | CC(=O)O[C@H]1C2=C(C(=O)C(=O)C(C)=C2O)[C@](C)(CC/C=C(/CCC=C(C)C)C(=O)O)[C@H]2CCC(C)(O)[C@H]12 |
| InChI | InChI=1S/C29H38O8/c1-15(2)9-7-10-18(27(34)35)11-8-13-28(5)19-12-14-29(6,36)21(19)26(37-17(4)30)20-22(28)25(33)24(32)16(3)23(20)31/h9,11,19,21,26,31,36H,7-8,10,12-14H2,1-6H3,(H,34,35)/b18-11-/t19-,21-,26-,28+,29?/m0/s1 |
| InChIKey | CDOCDVVBBNLDIB-BJTJJYOISA-N |
| XLogP | 4.53 |
| TPSA | 138.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.62 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|