C28H23N5O4S — CID 177447902
(E)-N-[4,5-bis(4-nitrophenyl)-1,3-thiazol-2-yl]-1-(1-butylindol-3-yl)methanimine (PubChem CID 177447902) has the molecular formula C28H23N5O4S and a molecular weight of 525.59 g/mol. Its IUPAC name is (E)-N-[4,5-bis(4-nitrophenyl)-1,3-thiazol-2-yl]-1-(1-butylindol-3-yl)methanimine.
| Compound Name | (E)-N-[4,5-bis(4-nitrophenyl)-1,3-thiazol-2-yl]-1-(1-butylindol-3-yl)methanimine |
|---|---|
| PubChem CID | 177447902 |
| Molecular Formula | C28H23N5O4S |
| Molecular Weight | 525.59 g/mol |
| Exact Mass | 525.15 |
| IUPAC Name | (E)-N-[4,5-bis(4-nitrophenyl)-1,3-thiazol-2-yl]-1-(1-butylindol-3-yl)methanimine |
| SMILES | CCCCn1cc(/C=N/c2nc(-c3ccc([N+](=O)[O-])cc3)c(-c3ccc([N+](=O)[O-])cc3)s2)c2ccccc21 |
| InChI | InChI=1S/C28H23N5O4S/c1-2-3-16-31-18-21(24-6-4-5-7-25(24)31)17-29-28-30-26(19-8-12-22(13-9-19)32(34)35)27(38-28)20-10-14-23(15-11-20)33(36)37/h4-15,17-18H,2-3,16H2,1H3/b29-17+ |
| InChIKey | BCZZWUIGPREVRF-STBIYBPSSA-N |
| XLogP | 7.80 |
| TPSA | 116.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.59 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|