C16H19N5S — CID 74763086
N-[(E)-(1-pentylindol-3-yl)methylideneamino]-1,3,4-thiadiazol-2-amine (PubChem CID 74763086) has the molecular formula C16H19N5S and a molecular weight of 313.43 g/mol. Its IUPAC name is N-[(E)-(1-pentylindol-3-yl)methylideneamino]-1,3,4-thiadiazol-2-amine.
| Compound Name | N-[(E)-(1-pentylindol-3-yl)methylideneamino]-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 74763086 |
| Molecular Formula | C16H19N5S |
| Molecular Weight | 313.43 g/mol |
| Exact Mass | 313.14 |
| IUPAC Name | N-[(E)-(1-pentylindol-3-yl)methylideneamino]-1,3,4-thiadiazol-2-amine |
| SMILES | CCCCCn1cc(/C=N/Nc2nncs2)c2ccccc21 |
| InChI | InChI=1S/C16H19N5S/c1-2-3-6-9-21-11-13(14-7-4-5-8-15(14)21)10-17-19-16-20-18-12-22-16/h4-5,7-8,10-12H,2-3,6,9H2,1H3,(H,19,20)/b17-10+ |
| InChIKey | LDCYALQRTOCIAS-LICLKQGHSA-N |
| XLogP | 4.13 |
| TPSA | 55.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.43 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|