C20H20N3O2- — CID 7346911
2-[(2E)-2-[(1-butylindol-3-yl)methylidene]hydrazinyl]benzoate (PubChem CID 7346911) has the molecular formula C20H20N3O2- and a molecular weight of 334.40 g/mol. Its IUPAC name is 2-[(2E)-2-[(1-butylindol-3-yl)methylidene]hydrazinyl]benzoate.
| Compound Name | 2-[(2E)-2-[(1-butylindol-3-yl)methylidene]hydrazinyl]benzoate |
|---|---|
| PubChem CID | 7346911 |
| Molecular Formula | C20H20N3O2- |
| Molecular Weight | 334.40 g/mol |
| Exact Mass | 334.16 |
| IUPAC Name | 2-[(2E)-2-[(1-butylindol-3-yl)methylidene]hydrazinyl]benzoate |
| SMILES | CCCCn1cc(/C=N/Nc2ccccc2C(=O)[O-])c2ccccc21 |
| InChI | InChI=1S/C20H21N3O2/c1-2-3-12-23-14-15(16-8-5-7-11-19(16)23)13-21-22-18-10-6-4-9-17(18)20(24)25/h4-11,13-14,22H,2-3,12H2,1H3,(H,24,25)/p-1/b21-13+ |
| InChIKey | CMUKQEBWRCYFTO-FYJGNVAPSA-M |
| XLogP | 3.25 |
| TPSA | 69.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.40 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_thiophene_A(11)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|