C25H36O7 — CID 177450228
(1S,4R,8S,9R,10R,12R)-9-[(3R)-3-hydroperoxy-3-methyl-5-[(2S)-3-methyl-5-oxo-2H-furan-2-yl]pent-4-enyl]-10-hydroxy-4,8,10-trimethyl-2-oxatricyclo[6.3.1.04,12]dodecan-3-one (PubChem CID 177450228) has the molecular formula C25H36O7 and a molecular weight of 448.56 g/mol. Its IUPAC name is (1S,4R,8S,9R,10R,12R)-9-[(3R)-3-hydroperoxy-3-methyl-5-[(2S)-3-methyl-5-oxo-2H-furan-2-yl]pent-4-enyl]-10-hydroxy-4,8,10-trimethyl-2-oxatricyclo[6.3.1.04,12]dodecan-3-one.
| Compound Name | (1S,4R,8S,9R,10R,12R)-9-[(3R)-3-hydroperoxy-3-methyl-5-[(2S)-3-methyl-5-oxo-2H-furan-2-yl]pent-4-enyl]-10-hydroxy-4,8,10-trimethyl-2-oxatricyclo[6.3.1.04,12]dodecan-3-one |
|---|---|
| PubChem CID | 177450228 |
| Molecular Formula | C25H36O7 |
| Molecular Weight | 448.56 g/mol |
| Exact Mass | 448.25 |
| IUPAC Name | (1S,4R,8S,9R,10R,12R)-9-[(3R)-3-hydroperoxy-3-methyl-5-[(2S)-3-methyl-5-oxo-2H-furan-2-yl]pent-4-enyl]-10-hydroxy-4,8,10-trimethyl-2-oxatricyclo[6.3.1.04,12]dodecan-3-one |
| SMILES | CC1=CC(=O)O[C@H]1C=C[C@@](C)(CC[C@@H]1[C@@]2(C)CCC[C@@]3(C)C(=O)O[C@@H](C[C@@]1(C)O)[C@H]23)OO |
| InChI | InChI=1S/C25H36O7/c1-15-13-19(26)30-16(15)7-11-22(2,32-29)12-8-18-23(3)9-6-10-24(4)20(23)17(31-21(24)27)14-25(18,5)28/h7,11,13,16-18,20,28-29H,6,8-10,12,14H2,1-5H3/t16-,17-,18+,20+,22-,23+,24+,25+/m0/s1 |
| InChIKey | GSHNDISVGWHAIW-FZCKDXJJSA-N |
| XLogP | 3.95 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.56 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|