C27H40N2O10S — CID 177453418
3-O-benzyl 1-O-[3-[(2R)-3-methoxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxopropyl]sulfanylpropyl] (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanedioate (PubChem CID 177453418) has the molecular formula C27H40N2O10S and a molecular weight of 584.69 g/mol. Its IUPAC name is 3-O-benzyl 1-O-[3-[(2R)-3-methoxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxopropyl]sulfanylpropyl] (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanedioate.
| Compound Name | 3-O-benzyl 1-O-[3-[(2R)-3-methoxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxopropyl]sulfanylpropyl] (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanedioate |
|---|---|
| PubChem CID | 177453418 |
| Molecular Formula | C27H40N2O10S |
| Molecular Weight | 584.69 g/mol |
| Exact Mass | 584.24 |
| IUPAC Name | 3-O-benzyl 1-O-[3-[(2R)-3-methoxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxopropyl]sulfanylpropyl] (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanedioate |
| SMILES | COC(=O)[C@H](CSCCCOC(=O)[C@H](NC(=O)OC(C)(C)C)C(=O)OCc1ccccc1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C27H40N2O10S/c1-26(2,3)38-24(33)28-19(21(30)35-7)17-40-15-11-14-36-22(31)20(29-25(34)39-27(4,5)6)23(32)37-16-18-12-9-8-10-13-18/h8-10,12-13,19-20H,11,14-17H2,1-7H3,(H,28,33)(H,29,34)/t19-,20-/m0/s1 |
| InChIKey | WGPNXHAZPLIZDF-PMACEKPBSA-N |
| XLogP | 3.36 |
| TPSA | 155.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.69 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|