C28H40O4 — CID 177453527
3-[[(2S,3aR,5aR,6R,9aR,9bS)-5a,9b-dimethyl-7-methylidene-2-(2-methylprop-1-enyl)-2,3a,4,5,6,8,9,9a-octahydro-1H-benzo[e][1]benzofuran-6-yl]methyl]-2-methoxy-5,6-dimethylpyran-4-one (PubChem CID 177453527) has the molecular formula C28H40O4 and a molecular weight of 440.62 g/mol. Its IUPAC name is 3-[[(2S,3aR,5aR,6R,9aR,9bS)-5a,9b-dimethyl-7-methylidene-2-(2-methylprop-1-enyl)-2,3a,4,5,6,8,9,9a-octahydro-1H-benzo[e][1]benzofuran-6-yl]methyl]-2-methoxy-5,6-dimethylpyran-4-one.
| Compound Name | 3-[[(2S,3aR,5aR,6R,9aR,9bS)-5a,9b-dimethyl-7-methylidene-2-(2-methylprop-1-enyl)-2,3a,4,5,6,8,9,9a-octahydro-1H-benzo[e][1]benzofuran-6-yl]methyl]-2-methoxy-5,6-dimethylpyran-4-one |
|---|---|
| PubChem CID | 177453527 |
| Molecular Formula | C28H40O4 |
| Molecular Weight | 440.62 g/mol |
| Exact Mass | 440.29 |
| IUPAC Name | 3-[[(2S,3aR,5aR,6R,9aR,9bS)-5a,9b-dimethyl-7-methylidene-2-(2-methylprop-1-enyl)-2,3a,4,5,6,8,9,9a-octahydro-1H-benzo[e][1]benzofuran-6-yl]methyl]-2-methoxy-5,6-dimethylpyran-4-one |
| SMILES | C=C1CC[C@@H]2[C@](C)(CC[C@H]3O[C@H](C=C(C)C)C[C@@]23C)[C@@H]1Cc1c(OC)oc(C)c(C)c1=O |
| InChI | InChI=1S/C28H40O4/c1-16(2)13-20-15-28(7)23-10-9-17(3)22(27(23,6)12-11-24(28)32-20)14-21-25(29)18(4)19(5)31-26(21)30-8/h13,20,22-24H,3,9-12,14-15H2,1-2,4-8H3/t20-,22-,23-,24-,27-,28+/m1/s1 |
| InChIKey | WLKOBHJLXQNYFG-RERAFBBNSA-N |
| XLogP | 6.32 |
| TPSA | 48.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.62 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|