C25H35N2+ — CID 177453801
(5Z,11E,18Z)-1-aza-13-azoniatetracyclo[20.3.1.19,13.011,23]heptacosa-5,9,11(23),13(27),18,22(26)-hexaene (PubChem CID 177453801) has the molecular formula C25H35N2+ and a molecular weight of 363.57 g/mol. Its IUPAC name is (5Z,11E,18Z)-1-aza-13-azoniatetracyclo[20.3.1.19,13.011,23]heptacosa-5,9,11(23),13(27),18,22(26)-hexaene.
| Compound Name | (5Z,11E,18Z)-1-aza-13-azoniatetracyclo[20.3.1.19,13.011,23]heptacosa-5,9,11(23),13(27),18,22(26)-hexaene |
|---|---|
| PubChem CID | 177453801 |
| Molecular Formula | C25H35N2+ |
| Molecular Weight | 363.57 g/mol |
| Exact Mass | 363.28 |
| IUPAC Name | (5Z,11E,18Z)-1-aza-13-azoniatetracyclo[20.3.1.19,13.011,23]heptacosa-5,9,11(23),13(27),18,22(26)-hexaene |
| SMILES | C1=C2C=[N+]3CCCC/C=C\CCC4=CN(CCC/C=C\CC2)CC/C4=C/1C3 |
| InChI | InChI=1S/C25H35N2/c1-2-6-11-16-27-19-22-12-8-4-3-7-10-15-26-17-14-25(24(18-22)21-27)23(20-26)13-9-5-1/h1,3-5,18-20H,2,6-17,21H2/q+1/b4-3-,5-1- |
| InChIKey | DARADLMQZRGGJF-IJGLLSCASA-N |
| XLogP | 5.55 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.57 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|