C16H14N2O3 — CID 177461237
(2Z)-2-(2-ethylpyridazin-3-ylidene)-5-methoxyindene-1,3-dione (PubChem CID 177461237) has the molecular formula C16H14N2O3 and a molecular weight of 282.30 g/mol. Its IUPAC name is (2Z)-2-(2-ethylpyridazin-3-ylidene)-5-methoxyindene-1,3-dione.
| Compound Name | (2Z)-2-(2-ethylpyridazin-3-ylidene)-5-methoxyindene-1,3-dione |
|---|---|
| PubChem CID | 177461237 |
| Molecular Formula | C16H14N2O3 |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | (2Z)-2-(2-ethylpyridazin-3-ylidene)-5-methoxyindene-1,3-dione |
| SMILES | CCN1N=CC=C/C1=C1\C(=O)c2ccc(OC)cc2C1=O |
| InChI | InChI=1S/C16H14N2O3/c1-3-18-13(5-4-8-17-18)14-15(19)11-7-6-10(21-2)9-12(11)16(14)20/h4-9H,3H2,1-2H3/b14-13- |
| InChIKey | QZEJVRFFYDJOQB-YPKPFQOOSA-N |
| XLogP | 2.21 |
| TPSA | 58.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.30 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_one_A(55)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|