C15H19ClO — CID 177462399
(3Z)-3-[(4-chlorophenyl)methylidene]-2,2-diethyloxolane (PubChem CID 177462399) has the molecular formula C15H19ClO and a molecular weight of 250.77 g/mol. Its IUPAC name is (3Z)-3-[(4-chlorophenyl)methylidene]-2,2-diethyloxolane.
| Compound Name | (3Z)-3-[(4-chlorophenyl)methylidene]-2,2-diethyloxolane |
|---|---|
| PubChem CID | 177462399 |
| Molecular Formula | C15H19ClO |
| Molecular Weight | 250.77 g/mol |
| Exact Mass | 250.11 |
| IUPAC Name | (3Z)-3-[(4-chlorophenyl)methylidene]-2,2-diethyloxolane |
| SMILES | CCC1(CC)OCC/C1=C/c1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H19ClO/c1-3-15(4-2)13(9-10-17-15)11-12-5-7-14(16)8-6-12/h5-8,11H,3-4,9-10H2,1-2H3/b13-11- |
| InChIKey | LABNJWIWAIPXCR-QBFSEMIESA-N |
| XLogP | 4.70 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.77 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |