C17H20NO2P — CID 177467359
(4S,5R)-2-(4-methoxyphenyl)-3,4-dimethyl-5-phenyl-1,3,2-oxazaphospholidine (PubChem CID 177467359) has the molecular formula C17H20NO2P and a molecular weight of 301.33 g/mol. Its IUPAC name is (4S,5R)-2-(4-methoxyphenyl)-3,4-dimethyl-5-phenyl-1,3,2-oxazaphospholidine.
| Compound Name | (4S,5R)-2-(4-methoxyphenyl)-3,4-dimethyl-5-phenyl-1,3,2-oxazaphospholidine |
|---|---|
| PubChem CID | 177467359 |
| Molecular Formula | C17H20NO2P |
| Molecular Weight | 301.33 g/mol |
| Exact Mass | 301.12 |
| IUPAC Name | (4S,5R)-2-(4-methoxyphenyl)-3,4-dimethyl-5-phenyl-1,3,2-oxazaphospholidine |
| SMILES | COc1ccc(P2O[C@H](c3ccccc3)[C@H](C)N2C)cc1 |
| InChI | InChI=1S/C17H20NO2P/c1-13-17(14-7-5-4-6-8-14)20-21(18(13)2)16-11-9-15(19-3)10-12-16/h4-13,17H,1-3H3/t13-,17-,21?/m0/s1 |
| InChIKey | SAYWIASZRAIQMT-PMJXDKCKSA-N |
| XLogP | 3.72 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.33 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|