C23H33NO7 — CID 177469599
trans-(5S,11S)-5-benzyl-6-(methoxymethoxy)-4,11-dimethyl-2-propan-2-yl-1,9-dioxa-4-azacyclododecane-3,8,12-trione (PubChem CID 177469599) has the molecular formula C23H33NO7 and a molecular weight of 435.52 g/mol. Its IUPAC name is trans-(5S,11S)-5-benzyl-6-(methoxymethoxy)-4,11-dimethyl-2-propan-2-yl-1,9-dioxa-4-azacyclododecane-3,8,12-trione.
| Compound Name | trans-(5S,11S)-5-benzyl-6-(methoxymethoxy)-4,11-dimethyl-2-propan-2-yl-1,9-dioxa-4-azacyclododecane-3,8,12-trione |
|---|---|
| PubChem CID | 177469599 |
| Molecular Formula | C23H33NO7 |
| Molecular Weight | 435.52 g/mol |
| Exact Mass | 435.23 |
| IUPAC Name | trans-(5S,11S)-5-benzyl-6-(methoxymethoxy)-4,11-dimethyl-2-propan-2-yl-1,9-dioxa-4-azacyclododecane-3,8,12-trione |
| SMILES | COCOC1CC(=O)OC[C@H](C)C(=O)OC(C(C)C)C(=O)N(C)[C@H]1Cc1ccccc1 |
| InChI | InChI=1S/C23H33NO7/c1-15(2)21-22(26)24(4)18(11-17-9-7-6-8-10-17)19(30-14-28-5)12-20(25)29-13-16(3)23(27)31-21/h6-10,15-16,18-19,21H,11-14H2,1-5H3/t16-,18-,19?,21?/m0/s1 |
| InChIKey | ABJHZTBPBIEJNR-SAIHOINMSA-N |
| XLogP | 2.20 |
| TPSA | 91.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.52 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|