C20H26O6 — CID 90178333
(8-benzyl-2-ethyl-4,9-dioxo-1,5-dioxonan-7-yl) 2-methylpropanoate (PubChem CID 90178333) has the molecular formula C20H26O6 and a molecular weight of 362.42 g/mol. Its IUPAC name is (8-benzyl-2-ethyl-4,9-dioxo-1,5-dioxonan-7-yl) 2-methylpropanoate.
| Compound Name | (8-benzyl-2-ethyl-4,9-dioxo-1,5-dioxonan-7-yl) 2-methylpropanoate |
|---|---|
| PubChem CID | 90178333 |
| Molecular Formula | C20H26O6 |
| Molecular Weight | 362.42 g/mol |
| Exact Mass | 362.17 |
| IUPAC Name | (8-benzyl-2-ethyl-4,9-dioxo-1,5-dioxonan-7-yl) 2-methylpropanoate |
| SMILES | CCC1CC(=O)OCC(OC(=O)C(C)C)C(Cc2ccccc2)C(=O)O1 |
| InChI | InChI=1S/C20H26O6/c1-4-15-11-18(21)24-12-17(26-19(22)13(2)3)16(20(23)25-15)10-14-8-6-5-7-9-14/h5-9,13,15-17H,4,10-12H2,1-3H3 |
| InChIKey | YDMWJCLOOLPSGH-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.42 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|