About (8-benzyl-2-ethyl-4,9-dioxo-1,5-dioxonan-7-yl) 2-methylpropanoate
(8-benzyl-2-ethyl-4,9-dioxo-1,5-dioxonan-7-yl) 2-methylpropanoate (PubChem CID 90178333) has the molecular formula C20H26O6
and a molecular weight of 362.42 g/mol. Its IUPAC name is (8-benzyl-2-ethyl-4,9-dioxo-1,5-dioxonan-7-yl) 2-methylpropanoate.
Molecular Properties
| Compound Name | (8-benzyl-2-ethyl-4,9-dioxo-1,5-dioxonan-7-yl) 2-methylpropanoate |
| PubChem CID | 90178333 |
| Molecular Formula | C20H26O6 |
| Molecular Weight | 362.42 g/mol |
| Exact Mass | 362.17 |
| IUPAC Name | (8-benzyl-2-ethyl-4,9-dioxo-1,5-dioxonan-7-yl) 2-methylpropanoate |
| SMILES | CCC1CC(=O)OCC(OC(=O)C(C)C)C(Cc2ccccc2)C(=O)O1 |
| InChI | InChI=1S/C20H26O6/c1-4-15-11-18(21)24-12-17(26-19(22)13(2)3)16(20(23)25-15)10-14-8-6-5-7-9-14/h5-9,13,15-17H,4,10-12H2,1-3H3 |
| InChIKey | YDMWJCLOOLPSGH-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.42 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|
Analyze (8-benzyl-2-ethyl-4,9-dioxo-1,5-dioxonan-7-yl) 2-methylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (8-benzyl-2-ethyl-4,9-dioxo-1,5-dioxonan-7-yl) 2-methylpropanoate?
The IUPAC name of (8-benzyl-2-ethyl-4,9-dioxo-1,5-dioxonan-7-yl) 2-methylpropanoate (CID 90178333) is (8-benzyl-2-ethyl-4,9-dioxo-1,5-dioxonan-7-yl) 2-methylpropanoate.
What is the SMILES notation for (8-benzyl-2-ethyl-4,9-dioxo-1,5-dioxonan-7-yl) 2-methylpropanoate?
The canonical SMILES for (8-benzyl-2-ethyl-4,9-dioxo-1,5-dioxonan-7-yl) 2-methylpropanoate is CCC1CC(=O)OCC(OC(=O)C(C)C)C(Cc2ccccc2)C(=O)O1.
What is the InChIKey of (8-benzyl-2-ethyl-4,9-dioxo-1,5-dioxonan-7-yl) 2-methylpropanoate?
The InChIKey is YDMWJCLOOLPSGH-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H26O6/c1-4-15-11-18(21)24-12-17(26-19(22)13(2)3)16(20(23)25-15)10-14-8-6-5-7-9-14/h5-9,13,15-17H,4,10-12H2,1-3H3.
What are the key properties of (8-benzyl-2-ethyl-4,9-dioxo-1,5-dioxonan-7-yl) 2-methylpropanoate?
(8-benzyl-2-ethyl-4,9-dioxo-1,5-dioxonan-7-yl) 2-methylpropanoate has a molecular weight of 362.42 g/mol, XLogP of 2.68, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (8-benzyl-2-ethyl-4,9-dioxo-1,5-dioxonan-7-yl) 2-methylpropanoate is sourced from PubChem (CID 90178333), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).