C33H41NO10 — CID 159800333
[2-[2-[(7R,8R,9S)-7-benzyl-9-methyl-8-(2-methylpropanoyloxy)-2,6-dioxo-1,5-dioxonan-3-yl]acetyl]-4-ethyl-3-pyridinyl]oxymethyl 2-methylpropanoate (PubChem CID 159800333) has the molecular formula C33H41NO10 and a molecular weight of 611.69 g/mol. Its IUPAC name is [2-[2-[(7R,8R,9S)-7-benzyl-9-methyl-8-(2-methylpropanoyloxy)-2,6-dioxo-1,5-dioxonan-3-yl]acetyl]-4-ethyl-3-pyridinyl]oxymethyl 2-methylpropanoate.
| Compound Name | [2-[2-[(7R,8R,9S)-7-benzyl-9-methyl-8-(2-methylpropanoyloxy)-2,6-dioxo-1,5-dioxonan-3-yl]acetyl]-4-ethyl-3-pyridinyl]oxymethyl 2-methylpropanoate |
|---|---|
| PubChem CID | 159800333 |
| Molecular Formula | C33H41NO10 |
| Molecular Weight | 611.69 g/mol |
| Exact Mass | 611.27 |
| IUPAC Name | [2-[2-[(7R,8R,9S)-7-benzyl-9-methyl-8-(2-methylpropanoyloxy)-2,6-dioxo-1,5-dioxonan-3-yl]acetyl]-4-ethyl-3-pyridinyl]oxymethyl 2-methylpropanoate |
| SMILES | CCc1ccnc(C(=O)CC2COC(=O)[C@H](Cc3ccccc3)[C@@H](OC(=O)C(C)C)[C@H](C)OC2=O)c1OCOC(=O)C(C)C |
| InChI | InChI=1S/C33H41NO10/c1-7-23-13-14-34-27(29(23)41-18-42-30(36)19(2)3)26(35)16-24-17-40-33(39)25(15-22-11-9-8-10-12-22)28(21(6)43-32(24)38)44-31(37)20(4)5/h8-14,19-21,24-25,28H,7,15-18H2,1-6H3/t21-,24?,25+,28-/m0/s1 |
| InChIKey | NJRYDQREFGJYHL-BYDDDOFTSA-N |
| XLogP | 4.28 |
| TPSA | 144.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.69 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|