C32H38N2O11 — CID 145116653
[2-[[(7R,8R,9S)-7-benzyl-9-methyl-8-(2-methylpropanoyloxy)-2,6-dioxo-1,5-dioxonan-3-yl]methylidenecarbamoyl]-4-methoxy-3-pyridinyl]oxymethyl 2-methylpropanoate (PubChem CID 145116653) has the molecular formula C32H38N2O11 and a molecular weight of 626.66 g/mol. Its IUPAC name is [2-[[(7R,8R,9S)-7-benzyl-9-methyl-8-(2-methylpropanoyloxy)-2,6-dioxo-1,5-dioxonan-3-yl]methylidenecarbamoyl]-4-methoxy-3-pyridinyl]oxymethyl 2-methylpropanoate.
| Compound Name | [2-[[(7R,8R,9S)-7-benzyl-9-methyl-8-(2-methylpropanoyloxy)-2,6-dioxo-1,5-dioxonan-3-yl]methylidenecarbamoyl]-4-methoxy-3-pyridinyl]oxymethyl 2-methylpropanoate |
|---|---|
| PubChem CID | 145116653 |
| Molecular Formula | C32H38N2O11 |
| Molecular Weight | 626.66 g/mol |
| Exact Mass | 626.25 |
| IUPAC Name | [2-[[(7R,8R,9S)-7-benzyl-9-methyl-8-(2-methylpropanoyloxy)-2,6-dioxo-1,5-dioxonan-3-yl]methylidenecarbamoyl]-4-methoxy-3-pyridinyl]oxymethyl 2-methylpropanoate |
| SMILES | COc1ccnc(C(=O)/N=C/C2COC(=O)[C@H](Cc3ccccc3)[C@@H](OC(=O)C(C)C)[C@H](C)OC2=O)c1OCOC(=O)C(C)C |
| InChI | InChI=1S/C32H38N2O11/c1-18(2)29(36)43-17-42-27-24(40-6)12-13-33-25(27)28(35)34-15-22-16-41-32(39)23(14-21-10-8-7-9-11-21)26(20(5)44-31(22)38)45-30(37)19(3)4/h7-13,15,18-20,22-23,26H,14,16-17H2,1-6H3/b34-15+/t20-,22?,23+,26-/m0/s1 |
| InChIKey | BHIARXAUYZLSLA-GQHXEORFSA-N |
| XLogP | 3.37 |
| TPSA | 165.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.66 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|