C22H41IO3Si — CID 177473709
[(4S,5S,6R,7E)-6-[tert-butyl(dimethyl)silyl]oxy-9-iodo-5,7-dimethylnona-1,7-dien-4-yl] 2,2-dimethylpropanoate (PubChem CID 177473709) has the molecular formula C22H41IO3Si and a molecular weight of 508.56 g/mol. Its IUPAC name is [(4S,5S,6R,7E)-6-[tert-butyl(dimethyl)silyl]oxy-9-iodo-5,7-dimethylnona-1,7-dien-4-yl] 2,2-dimethylpropanoate.
| Compound Name | [(4S,5S,6R,7E)-6-[tert-butyl(dimethyl)silyl]oxy-9-iodo-5,7-dimethylnona-1,7-dien-4-yl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 177473709 |
| Molecular Formula | C22H41IO3Si |
| Molecular Weight | 508.56 g/mol |
| Exact Mass | 508.19 |
| IUPAC Name | [(4S,5S,6R,7E)-6-[tert-butyl(dimethyl)silyl]oxy-9-iodo-5,7-dimethylnona-1,7-dien-4-yl] 2,2-dimethylpropanoate |
| SMILES | C=CC[C@H](OC(=O)C(C)(C)C)[C@H](C)[C@@H](O[Si](C)(C)C(C)(C)C)/C(C)=C/CI |
| InChI | InChI=1S/C22H41IO3Si/c1-12-13-18(25-20(24)21(4,5)6)17(3)19(16(2)14-15-23)26-27(10,11)22(7,8)9/h12,14,17-19H,1,13,15H2,2-11H3/b16-14+/t17-,18-,19-/m0/s1 |
| InChIKey | SJZIXJOLCFYAPU-AUIFCJDBSA-N |
| XLogP | 6.93 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.56 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|