C29H56O3Si — CID 71584366
[(3S,6E,10S,11R)-11-[tert-butyl(dimethyl)silyl]oxy-3,7-dimethyl-10-propan-2-yltrideca-6,12-dienyl] 2,2-dimethylpropanoate (PubChem CID 71584366) has the molecular formula C29H56O3Si and a molecular weight of 480.85 g/mol. Its IUPAC name is [(3S,6E,10S,11R)-11-[tert-butyl(dimethyl)silyl]oxy-3,7-dimethyl-10-propan-2-yltrideca-6,12-dienyl] 2,2-dimethylpropanoate.
| Compound Name | [(3S,6E,10S,11R)-11-[tert-butyl(dimethyl)silyl]oxy-3,7-dimethyl-10-propan-2-yltrideca-6,12-dienyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 71584366 |
| Molecular Formula | C29H56O3Si |
| Molecular Weight | 480.85 g/mol |
| Exact Mass | 480.40 |
| IUPAC Name | [(3S,6E,10S,11R)-11-[tert-butyl(dimethyl)silyl]oxy-3,7-dimethyl-10-propan-2-yltrideca-6,12-dienyl] 2,2-dimethylpropanoate |
| SMILES | C=C[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](CC/C(C)=C/CC[C@H](C)CCOC(=O)C(C)(C)C)C(C)C |
| InChI | InChI=1S/C29H56O3Si/c1-14-26(32-33(12,13)29(9,10)11)25(22(2)3)19-18-23(4)16-15-17-24(5)20-21-31-27(30)28(6,7)8/h14,16,22,24-26H,1,15,17-21H2,2-13H3/b23-16+/t24-,25-,26+/m0/s1 |
| InChIKey | JFNSUENPADVQQV-VBUCIEDTSA-N |
| XLogP | 8.96 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.85 |
| LogP ≤ 5 | 8.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|