C21H39IO3Si — CID 25197607
ethyl (2E,4R,5S,6S,8E)-9-iodo-2,4,6,8-tetramethyl-5-triethylsilyloxynona-2,8-dienoate (PubChem CID 25197607) has the molecular formula C21H39IO3Si and a molecular weight of 494.53 g/mol. Its IUPAC name is ethyl (2E,4R,5S,6S,8E)-9-iodo-2,4,6,8-tetramethyl-5-triethylsilyloxynona-2,8-dienoate.
| Compound Name | ethyl (2E,4R,5S,6S,8E)-9-iodo-2,4,6,8-tetramethyl-5-triethylsilyloxynona-2,8-dienoate |
|---|---|
| PubChem CID | 25197607 |
| Molecular Formula | C21H39IO3Si |
| Molecular Weight | 494.53 g/mol |
| Exact Mass | 494.17 |
| IUPAC Name | ethyl (2E,4R,5S,6S,8E)-9-iodo-2,4,6,8-tetramethyl-5-triethylsilyloxynona-2,8-dienoate |
| SMILES | CCOC(=O)/C(C)=C/[C@@H](C)[C@@H](O[Si](CC)(CC)CC)[C@@H](C)C/C(C)=C/I |
| InChI | InChI=1S/C21H39IO3Si/c1-9-24-21(23)19(8)14-18(7)20(17(6)13-16(5)15-22)25-26(10-2,11-3)12-4/h14-15,17-18,20H,9-13H2,1-8H3/b16-15+,19-14+/t17-,18+,20-/m0/s1 |
| InChIKey | SBMNWCJPXKITRE-YLSJHFPRSA-N |
| XLogP | 6.89 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.53 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|