C13H13Br2NO — CID 177474950
3-(2,2-dibromoethenyl)-1,3,7-trimethylindol-2-one (PubChem CID 177474950) has the molecular formula C13H13Br2NO and a molecular weight of 359.06 g/mol. Its IUPAC name is 3-(2,2-dibromoethenyl)-1,3,7-trimethylindol-2-one.
| Compound Name | 3-(2,2-dibromoethenyl)-1,3,7-trimethylindol-2-one |
|---|---|
| PubChem CID | 177474950 |
| Molecular Formula | C13H13Br2NO |
| Molecular Weight | 359.06 g/mol |
| Exact Mass | 356.94 |
| IUPAC Name | 3-(2,2-dibromoethenyl)-1,3,7-trimethylindol-2-one |
| SMILES | Cc1cccc2c1N(C)C(=O)C2(C)C=C(Br)Br |
| InChI | InChI=1S/C13H13Br2NO/c1-8-5-4-6-9-11(8)16(3)12(17)13(9,2)7-10(14)15/h4-7H,1-3H3 |
| InChIKey | XBWBSJWATNDTMA-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.06 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |