C12H13NO — CID 102104060
1',7'-dimethylspiro[cyclopropane-1,3'-indole]-2'-one (PubChem CID 102104060) has the molecular formula C12H13NO and a molecular weight of 187.24 g/mol. Its IUPAC name is 1',7'-dimethylspiro[cyclopropane-1,3'-indole]-2'-one.
| Compound Name | 1',7'-dimethylspiro[cyclopropane-1,3'-indole]-2'-one |
|---|---|
| PubChem CID | 102104060 |
| Molecular Formula | C12H13NO |
| Molecular Weight | 187.24 g/mol |
| Exact Mass | 187.10 |
| IUPAC Name | 1',7'-dimethylspiro[cyclopropane-1,3'-indole]-2'-one |
| SMILES | Cc1cccc2c1N(C)C(=O)C21CC1 |
| InChI | InChI=1S/C12H13NO/c1-8-4-3-5-9-10(8)13(2)11(14)12(9)6-7-12/h3-5H,6-7H2,1-2H3 |
| InChIKey | DBTGFMDPLSBQMU-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.24 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |